C10H12N4O6S — CID 97166524
(2S)-1-[(3-nitro-2-pyridinyl)sulfonyl]piperazine-2-carboxylic acid (PubChem CID 97166524) has the molecular formula C10H12N4O6S and a molecular weight of 316.30 g/mol. Its IUPAC name is (2S)-1-[(3-nitro-2-pyridinyl)sulfonyl]piperazine-2-carboxylic acid.
| Compound Name | (2S)-1-[(3-nitro-2-pyridinyl)sulfonyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97166524 |
| Molecular Formula | C10H12N4O6S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (2S)-1-[(3-nitro-2-pyridinyl)sulfonyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CNCCN1S(=O)(=O)c1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N4O6S/c15-10(16)8-6-11-4-5-13(8)21(19,20)9-7(14(17)18)2-1-3-12-9/h1-3,8,11H,4-6H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | DHBPJFJYXCDINI-QMMMGPOBSA-N |
| XLogP | -0.96 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|