C14H24ClNO2 — CID 71638045
2-[3-[1-(furan-2-yl)ethoxy]propyl]piperidine;hydrochloride (PubChem CID 71638045) has the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. Its IUPAC name is 2-[3-[1-(furan-2-yl)ethoxy]propyl]piperidine;hydrochloride.
| Compound Name | 2-[3-[1-(furan-2-yl)ethoxy]propyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 71638045 |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[3-[1-(furan-2-yl)ethoxy]propyl]piperidine;hydrochloride |
| SMILES | CC(OCCCC1CCCCN1)c1ccco1.Cl |
| InChI | InChI=1S/C14H23NO2.ClH/c1-12(14-8-5-11-17-14)16-10-4-7-13-6-2-3-9-15-13;/h5,8,11-13,15H,2-4,6-7,9-10H2,1H3;1H |
| InChIKey | VCLOSPSPRQQZKP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|