C14H24ClNOS — CID 71638047
2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine;hydrochloride (PubChem CID 71638047) has the molecular formula C14H24ClNOS and a molecular weight of 289.87 g/mol. Its IUPAC name is 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine;hydrochloride.
| Compound Name | 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 71638047 |
| Molecular Formula | C14H24ClNOS |
| Molecular Weight | 289.87 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[3-(1-thiophen-2-ylethoxy)propyl]piperidine;hydrochloride |
| SMILES | CC(OCCCC1CCCCN1)c1cccs1.Cl |
| InChI | InChI=1S/C14H23NOS.ClH/c1-12(14-8-5-11-17-14)16-10-4-7-13-6-2-3-9-15-13;/h5,8,11-13,15H,2-4,6-7,9-10H2,1H3;1H |
| InChIKey | FFFOFSNDECZQQJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|