C12H19N3O2S — CID 71638895
[1-[(4-methyl-2-pyridinyl)sulfonyl]piperidin-2-yl]methanamine (PubChem CID 71638895) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is [1-[(4-methyl-2-pyridinyl)sulfonyl]piperidin-2-yl]methanamine.
| Compound Name | [1-[(4-methyl-2-pyridinyl)sulfonyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 71638895 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [1-[(4-methyl-2-pyridinyl)sulfonyl]piperidin-2-yl]methanamine |
| SMILES | Cc1ccnc(S(=O)(=O)N2CCCCC2CN)c1 |
| InChI | InChI=1S/C12H19N3O2S/c1-10-5-6-14-12(8-10)18(16,17)15-7-3-2-4-11(15)9-13/h5-6,8,11H,2-4,7,9,13H2,1H3 |
| InChIKey | RBJXCXBPKUYHGW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |