C11H18Cl2N4 — CID 71639098
4-chloro-5-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine;hydrochloride (PubChem CID 71639098) has the molecular formula C11H18Cl2N4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 4-chloro-5-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine;hydrochloride.
| Compound Name | 4-chloro-5-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71639098 |
| Molecular Formula | C11H18Cl2N4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-chloro-5-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine;hydrochloride |
| SMILES | Cc1cnc(NCC2CCCNC2)nc1Cl.Cl |
| InChI | InChI=1S/C11H17ClN4.ClH/c1-8-5-14-11(16-10(8)12)15-7-9-3-2-4-13-6-9;/h5,9,13H,2-4,6-7H2,1H3,(H,14,15,16);1H |
| InChIKey | BIBQGPBCQPEAPG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |