C20H23N4O2S2+ — CID 7163930
2-(1,3-benzothiazole-6-carbonylamino)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 7163930) has the molecular formula C20H23N4O2S2+ and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-(1,3-benzothiazole-6-carbonylamino)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 2-(1,3-benzothiazole-6-carbonylamino)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 7163930 |
| Molecular Formula | C20H23N4O2S2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-(1,3-benzothiazole-6-carbonylamino)-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)c3ccc4ncsc4c3)c2C(N)=O)C(C)(C)[NH2+]1 |
| InChI | InChI=1S/C20H22N4O2S2/c1-19(2)8-11-14(16(21)25)18(28-15(11)20(3,4)24-19)23-17(26)10-5-6-12-13(7-10)27-9-22-12/h5-7,9,24H,8H2,1-4H3,(H2,21,25)(H,23,26)/p+1 |
| InChIKey | KJEBJPRPPXAEJW-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |