C21H26N3O2S+ — CID 7166808
N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)-4-ethoxybenzamide (PubChem CID 7166808) has the molecular formula C21H26N3O2S+ and a molecular weight of 384.53 g/mol. Its IUPAC name is N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)-4-ethoxybenzamide.
| Compound Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 7166808 |
| Molecular Formula | C21H26N3O2S+ |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2sc3c(c2C#N)CC(C)(C)[NH2+]C3(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O2S/c1-6-26-14-9-7-13(8-10-14)18(25)23-19-16(12-22)15-11-20(2,3)24-21(4,5)17(15)27-19/h7-10,24H,6,11H2,1-5H3,(H,23,25)/p+1 |
| InChIKey | NVGSULIFKYPPSS-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |