C19H29N4OS3+ — CID 9490914
[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 9490914) has the molecular formula C19H29N4OS3+ and a molecular weight of 425.67 g/mol. Its IUPAC name is [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 9490914 |
| Molecular Formula | C19H29N4OS3+ |
| Molecular Weight | 425.67 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1sc2c(c1C#N)CC(C)(C)[NH2+]C2(C)C |
| InChI | InChI=1S/C19H28N4OS3/c1-7-23(8-2)17(25)26-11-14(24)21-16-13(10-20)12-9-18(3,4)22-19(5,6)15(12)27-16/h22H,7-9,11H2,1-6H3,(H,21,24)/p+1 |
| InChIKey | SHMMZIFCWVGMIE-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|