C21H30N4OS2+2 — CID 8769807
[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8769807) has the molecular formula C21H30N4OS2+2 and a molecular weight of 418.63 g/mol. Its IUPAC name is [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8769807 |
| Molecular Formula | C21H30N4OS2+2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl]-ethyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](CC(=O)Nc1sc2c(c1C#N)CC(C)(C)[NH2+]C2(C)C)Cc1cccs1 |
| InChI | InChI=1S/C21H28N4OS2/c1-6-25(12-14-8-7-9-27-14)13-17(26)23-19-16(11-22)15-10-20(2,3)24-21(4,5)18(15)28-19/h7-9,24H,6,10,12-13H2,1-5H3,(H,23,26)/p+2 |
| InChIKey | FJJQINIUMNWCRL-UHFFFAOYSA-P |
| XLogP | 1.86 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |