C19H26N3O3S+ — CID 9230455
cis-[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] (1S,2R)-2-methylcyclopropane-1-carboxylate (PubChem CID 9230455) has the molecular formula C19H26N3O3S+ and a molecular weight of 376.50 g/mol. Its IUPAC name is cis-[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] (1S,2R)-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] (1S,2R)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 9230455 |
| Molecular Formula | C19H26N3O3S+ |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | cis-[2-[(3-cyano-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-2-yl)amino]-2-oxoethyl] (1S,2R)-2-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@H]1C[C@@H]1C(=O)OCC(=O)Nc1sc2c(c1C#N)CC(C)(C)[NH2+]C2(C)C |
| InChI | InChI=1S/C19H25N3O3S/c1-10-6-11(10)17(24)25-9-14(23)21-16-13(8-20)12-7-18(2,3)22-19(4,5)15(12)26-16/h10-11,22H,6-7,9H2,1-5H3,(H,21,23)/p+1/t10-,11+/m1/s1 |
| InChIKey | XRFHLGBNUOXHLR-MNOVXSKESA-O |
| XLogP | 1.89 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |