C18H30N3O2S2+ — CID 8624512
ethyl 5,5,7,7-tetramethyl-2-(propan-2-ylcarbamothioylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 8624512) has the molecular formula C18H30N3O2S2+ and a molecular weight of 384.59 g/mol. Its IUPAC name is ethyl 5,5,7,7-tetramethyl-2-(propan-2-ylcarbamothioylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | ethyl 5,5,7,7-tetramethyl-2-(propan-2-ylcarbamothioylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 8624512 |
| Molecular Formula | C18H30N3O2S2+ |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | ethyl 5,5,7,7-tetramethyl-2-(propan-2-ylcarbamothioylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(C)C)sc2c1CC(C)(C)[NH2+]C2(C)C |
| InChI | InChI=1S/C18H29N3O2S2/c1-8-23-15(22)12-11-9-17(4,5)21-18(6,7)13(11)25-14(12)20-16(24)19-10(2)3/h10,21H,8-9H2,1-7H3,(H2,19,20,24)/p+1 |
| InChIKey | BSKJSCALWFZGLA-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 66.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|