C24H30N5O3S2+ — CID 2714648
ethyl 5,5,7,7-tetramethyl-2-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 2714648) has the molecular formula C24H30N5O3S2+ and a molecular weight of 500.67 g/mol. Its IUPAC name is ethyl 5,5,7,7-tetramethyl-2-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | ethyl 5,5,7,7-tetramethyl-2-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 2714648 |
| Molecular Formula | C24H30N5O3S2+ |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | ethyl 5,5,7,7-tetramethyl-2-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nncn2-c2ccccc2)sc2c1CC(C)(C)[NH2+]C2(C)C |
| InChI | InChI=1S/C24H29N5O3S2/c1-6-32-21(31)18-16-12-23(2,3)28-24(4,5)19(16)34-20(18)26-17(30)13-33-22-27-25-14-29(22)15-10-8-7-9-11-15/h7-11,14,28H,6,12-13H2,1-5H3,(H,26,30)/p+1 |
| InChIKey | WAYDHAULOOPACB-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |