C19H25N2O3S2+ — CID 7163954
ethyl 5,5,7,7-tetramethyl-2-(thiophene-2-carbonylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 7163954) has the molecular formula C19H25N2O3S2+ and a molecular weight of 393.55 g/mol. Its IUPAC name is ethyl 5,5,7,7-tetramethyl-2-(thiophene-2-carbonylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | ethyl 5,5,7,7-tetramethyl-2-(thiophene-2-carbonylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 7163954 |
| Molecular Formula | C19H25N2O3S2+ |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | ethyl 5,5,7,7-tetramethyl-2-(thiophene-2-carbonylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccs2)sc2c1CC(C)(C)[NH2+]C2(C)C |
| InChI | InChI=1S/C19H24N2O3S2/c1-6-24-17(23)13-11-10-18(2,3)21-19(4,5)14(11)26-16(13)20-15(22)12-8-7-9-25-12/h7-9,21H,6,10H2,1-5H3,(H,20,22)/p+1 |
| InChIKey | DSNWJLJKOWHAQB-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |