C21H28N3O2S+ — CID 7177264
2-[(2,4-dimethylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 7177264) has the molecular formula C21H28N3O2S+ and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[(2,4-dimethylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 2-[(2,4-dimethylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 7177264 |
| Molecular Formula | C21H28N3O2S+ |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[(2,4-dimethylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2sc3c(c2C(N)=O)CC(C)(C)[NH2+]C3(C)C)c(C)c1 |
| InChI | InChI=1S/C21H27N3O2S/c1-11-7-8-13(12(2)9-11)18(26)23-19-15(17(22)25)14-10-20(3,4)24-21(5,6)16(14)27-19/h7-9,24H,10H2,1-6H3,(H2,22,25)(H,23,26)/p+1 |
| InChIKey | KWYJTLAXKGMBMY-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |