C21H28N3O3S+ — CID 7166727
5,5,7,7-tetramethyl-2-(3-phenoxypropanoylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 7166727) has the molecular formula C21H28N3O3S+ and a molecular weight of 402.54 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-2-(3-phenoxypropanoylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 5,5,7,7-tetramethyl-2-(3-phenoxypropanoylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 7166727 |
| Molecular Formula | C21H28N3O3S+ |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 5,5,7,7-tetramethyl-2-(3-phenoxypropanoylamino)-4,6-dihydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)CCOc3ccccc3)c2C(N)=O)C(C)(C)[NH2+]1 |
| InChI | InChI=1S/C21H27N3O3S/c1-20(2)12-14-16(18(22)26)19(28-17(14)21(3,4)24-20)23-15(25)10-11-27-13-8-6-5-7-9-13/h5-9,24H,10-12H2,1-4H3,(H2,22,26)(H,23,25)/p+1 |
| InChIKey | FSEPZYRMKSPPFK-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 98.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |