C16H18BrNO3S2 — CID 23996164
ethyl 5-bromo-4-(2-methylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 23996164) has the molecular formula C16H18BrNO3S2 and a molecular weight of 416.36 g/mol. Its IUPAC name is ethyl 5-bromo-4-(2-methylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-bromo-4-(2-methylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23996164 |
| Molecular Formula | C16H18BrNO3S2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | ethyl 5-bromo-4-(2-methylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccs2)sc(Br)c1CC(C)C |
| InChI | InChI=1S/C16H18BrNO3S2/c1-4-21-16(20)12-10(8-9(2)3)13(17)23-15(12)18-14(19)11-6-5-7-22-11/h5-7,9H,4,8H2,1-3H3,(H,18,19) |
| InChIKey | QKEXPYKIZTYYED-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |