C12H20N4S — CID 71643423
[1-[(3-methylsulfanylpyrazin-2-yl)methyl]piperidin-2-yl]methanamine (PubChem CID 71643423) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is [1-[(3-methylsulfanylpyrazin-2-yl)methyl]piperidin-2-yl]methanamine.
| Compound Name | [1-[(3-methylsulfanylpyrazin-2-yl)methyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 71643423 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [1-[(3-methylsulfanylpyrazin-2-yl)methyl]piperidin-2-yl]methanamine |
| SMILES | CSc1nccnc1CN1CCCCC1CN |
| InChI | InChI=1S/C12H20N4S/c1-17-12-11(14-5-6-15-12)9-16-7-3-2-4-10(16)8-13/h5-6,10H,2-4,7-9,13H2,1H3 |
| InChIKey | QHZDUTZUMHEPAD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |