C18H14FNO7 — CID 7164411
(5-fluoro-2-nitrophenyl) (2R,3R)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylate (PubChem CID 7164411) has the molecular formula C18H14FNO7 and a molecular weight of 375.31 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) (2R,3R)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylate.
| Compound Name | (5-fluoro-2-nitrophenyl) (2R,3R)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 7164411 |
| Molecular Formula | C18H14FNO7 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) (2R,3R)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylate |
| SMILES | COc1ccccc1[C@@H]1OC(=O)C[C@H]1C(=O)Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14FNO7/c1-25-14-5-3-2-4-11(14)17-12(9-16(21)27-17)18(22)26-15-8-10(19)6-7-13(15)20(23)24/h2-8,12,17H,9H2,1H3/t12-,17+/m1/s1 |
| InChIKey | KZCCZGYXUKCONJ-PXAZEXFGSA-N |
| XLogP | 2.95 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|