C12H19ClN2O2S — CID 71645755
4-(piperidin-3-ylmethylsulfonylmethyl)pyridine;hydrochloride (PubChem CID 71645755) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 4-(piperidin-3-ylmethylsulfonylmethyl)pyridine;hydrochloride.
| Compound Name | 4-(piperidin-3-ylmethylsulfonylmethyl)pyridine;hydrochloride |
|---|---|
| PubChem CID | 71645755 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-(piperidin-3-ylmethylsulfonylmethyl)pyridine;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccncc1)CC1CCCNC1 |
| InChI | InChI=1S/C12H18N2O2S.ClH/c15-17(16,9-11-3-6-13-7-4-11)10-12-2-1-5-14-8-12;/h3-4,6-7,12,14H,1-2,5,8-10H2;1H |
| InChIKey | NOMCJRFOGZUIGP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |