C12H18N2OS — CID 71646160
4-(piperidin-3-ylmethylsulfinylmethyl)pyridine (PubChem CID 71646160) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-(piperidin-3-ylmethylsulfinylmethyl)pyridine.
| Compound Name | 4-(piperidin-3-ylmethylsulfinylmethyl)pyridine |
|---|---|
| PubChem CID | 71646160 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-(piperidin-3-ylmethylsulfinylmethyl)pyridine |
| SMILES | O=S(Cc1ccncc1)CC1CCCNC1 |
| InChI | InChI=1S/C12H18N2OS/c15-16(9-11-3-6-13-7-4-11)10-12-2-1-5-14-8-12/h3-4,6-7,12,14H,1-2,5,8-10H2 |
| InChIKey | WSIYGKLMPOWGRV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |