C9H11FN4O2 — CID 71649695
4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxylic acid (PubChem CID 71649695) has the molecular formula C9H11FN4O2 and a molecular weight of 226.21 g/mol. Its IUPAC name is 4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxylic acid.
| Compound Name | 4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 71649695 |
| Molecular Formula | C9H11FN4O2 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-(5-fluoropyrimidin-2-yl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ncc(F)cn2)CCN1 |
| InChI | InChI=1S/C9H11FN4O2/c10-6-3-12-9(13-4-6)14-2-1-11-7(5-14)8(15)16/h3-4,7,11H,1-2,5H2,(H,15,16) |
| InChIKey | BYAGJFAWJHYCGX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |