C10H13F3N4O2 — CID 86673537
5-piperazin-1-ylpyrimidine;2,2,2-trifluoroacetic acid (PubChem CID 86673537) has the molecular formula C10H13F3N4O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is 5-piperazin-1-ylpyrimidine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-piperazin-1-ylpyrimidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86673537 |
| Molecular Formula | C10H13F3N4O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-piperazin-1-ylpyrimidine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ncc(N2CCNCC2)cn1 |
| InChI | InChI=1S/C8H12N4.C2HF3O2/c1-3-12(4-2-9-1)8-5-10-7-11-6-8;3-2(4,5)1(6)7/h5-7,9H,1-4H2;(H,6,7) |
| InChIKey | WPXQHVJNTFEXNJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |