C9H20N2O2 — CID 71650806
[(2R)-4-aminobutan-2-yl]-tert-butylcarbamic acid (PubChem CID 71650806) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is [(2R)-4-aminobutan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(2R)-4-aminobutan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 71650806 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | [(2R)-4-aminobutan-2-yl]-tert-butylcarbamic acid |
| SMILES | C[C@H](CCN)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-7(5-6-10)11(8(12)13)9(2,3)4/h7H,5-6,10H2,1-4H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | PKQADWDXIWOXRA-SSDOTTSWSA-N |
| XLogP | 1.50 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |