C9H18ClNO3 — CID 90074078
tert-butyl-[(2S,3R)-4-chloro-3-hydroxybutan-2-yl]carbamic acid (PubChem CID 90074078) has the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-4-chloro-3-hydroxybutan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2S,3R)-4-chloro-3-hydroxybutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90074078 |
| Molecular Formula | C9H18ClNO3 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | tert-butyl-[(2S,3R)-4-chloro-3-hydroxybutan-2-yl]carbamic acid |
| SMILES | C[C@@H]([C@@H](O)CCl)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H18ClNO3/c1-6(7(12)5-10)11(8(13)14)9(2,3)4/h6-7,12H,5H2,1-4H3,(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | FAROLSYIYFBGAS-BQBZGAKWSA-N |
| XLogP | 1.75 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|