C18H24ClN7O4 — CID 71651163
3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-1-ethylimidazo[4,5-c]pyridin-7-yl]oxypropyl-tert-butylcarbamic acid (PubChem CID 71651163) has the molecular formula C18H24ClN7O4 and a molecular weight of 437.89 g/mol. Its IUPAC name is 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-1-ethylimidazo[4,5-c]pyridin-7-yl]oxypropyl-tert-butylcarbamic acid.
| Compound Name | 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-1-ethylimidazo[4,5-c]pyridin-7-yl]oxypropyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 71651163 |
| Molecular Formula | C18H24ClN7O4 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-1-ethylimidazo[4,5-c]pyridin-7-yl]oxypropyl-tert-butylcarbamic acid |
| SMILES | CCn1c(-c2nonc2N)nc2c(Cl)ncc(OCCCN(C(=O)O)C(C)(C)C)c21 |
| InChI | InChI=1S/C18H24ClN7O4/c1-5-25-13-10(29-8-6-7-26(17(27)28)18(2,3)4)9-21-14(19)11(13)22-16(25)12-15(20)24-30-23-12/h9H,5-8H2,1-4H3,(H2,20,24)(H,27,28) |
| InChIKey | IEBYLEIBVZRXFO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|