C19H20F3N7O4 — CID 69299689
4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]but-3-yn-2-yl 2,2,2-trifluoroacetate (PubChem CID 69299689) has the molecular formula C19H20F3N7O4 and a molecular weight of 467.41 g/mol. Its IUPAC name is 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]but-3-yn-2-yl 2,2,2-trifluoroacetate.
| Compound Name | 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]but-3-yn-2-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69299689 |
| Molecular Formula | C19H20F3N7O4 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]but-3-yn-2-yl 2,2,2-trifluoroacetate |
| SMILES | CCn1c(-c2nonc2N)nc2c(C#CC(C)OC(=O)C(F)(F)F)ncc(OCCCN)c21 |
| InChI | InChI=1S/C19H20F3N7O4/c1-3-29-15-12(31-8-4-7-23)9-25-11(6-5-10(2)32-18(30)19(20,21)22)13(15)26-17(29)14-16(24)28-33-27-14/h9-10H,3-4,7-8,23H2,1-2H3,(H2,24,28) |
| InChIKey | TVKSJEUYONVOIC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|