C20H19NNaO2PS — CID 71652937
sodium benzylsulfanyl-[(4-phenylphenyl)methylamino]phosphinate (PubChem CID 71652937) has the molecular formula C20H19NNaO2PS and a molecular weight of 391.41 g/mol. Its IUPAC name is sodium benzylsulfanyl-[(4-phenylphenyl)methylamino]phosphinate.
| Compound Name | sodium benzylsulfanyl-[(4-phenylphenyl)methylamino]phosphinate |
|---|---|
| PubChem CID | 71652937 |
| Molecular Formula | C20H19NNaO2PS |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | sodium benzylsulfanyl-[(4-phenylphenyl)methylamino]phosphinate |
| SMILES | O=P([O-])(NCc1ccc(-c2ccccc2)cc1)SCc1ccccc1.[Na+] |
| InChI | InChI=1S/C20H20NO2PS.Na/c22-24(23,25-16-18-7-3-1-4-8-18)21-15-17-11-13-20(14-12-17)19-9-5-2-6-10-19;/h1-14H,15-16H2,(H2,21,22,23);/q;+1/p-1 |
| InChIKey | IFAIBVIUAJLILR-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|