C21H22Cl2N2O2 — CID 71652988
(E)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-1-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methanimine (PubChem CID 71652988) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is (E)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-1-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methanimine.
| Compound Name | (E)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-1-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 71652988 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (E)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-1-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methanimine |
| SMILES | Clc1cccc(Cl)c1COc1ccccc1/C=N/OC1CN2CCC1CC2 |
| InChI | InChI=1S/C21H22Cl2N2O2/c22-18-5-3-6-19(23)17(18)14-26-20-7-2-1-4-16(20)12-24-27-21-13-25-10-8-15(21)9-11-25/h1-7,12,15,21H,8-11,13-14H2/b24-12+ |
| InChIKey | MEHHKNPZDDGADU-WYMPLXKRSA-N |
| XLogP | 5.02 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|