C17H14N6O2S — CID 71654655
4-(4-methylphenyl)-3-[(5-nitroindazol-1-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 71654655) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-[(5-nitroindazol-1-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-methylphenyl)-3-[(5-nitroindazol-1-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 71654655 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-(4-methylphenyl)-3-[(5-nitroindazol-1-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(Cn3ncc4cc([N+](=O)[O-])ccc43)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H14N6O2S/c1-11-2-4-13(5-3-11)22-16(19-20-17(22)26)10-21-15-7-6-14(23(24)25)8-12(15)9-18-21/h2-9H,10H2,1H3,(H,20,26) |
| InChIKey | ITVJAWRTDBULSV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|