C30H32N4O4S — CID 71655259
5-[(1R,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-N-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 71655259) has the molecular formula C30H32N4O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is 5-[(1R,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-N-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(1R,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-N-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 71655259 |
| Molecular Formula | C30H32N4O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 5-[(1R,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-N-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccc(Nc2nnc([C@H]3C[C@@]45C=C[C@]3(OC)[C@@H]3Oc6c(OC)ccc7c6[C@@]34CCN(C)[C@@H]5C7)s2)cc1 |
| InChI | InChI=1S/C30H32N4O4S/c1-34-14-13-29-23-17-5-10-21(36-3)24(23)38-26(29)30(37-4)12-11-28(29,22(34)15-17)16-20(30)25-32-33-27(39-25)31-18-6-8-19(35-2)9-7-18/h5-12,20,22,26H,13-16H2,1-4H3,(H,31,33)/t20-,22-,26-,28-,29+,30-/m1/s1 |
| InChIKey | IXJVKUGVSMFLFF-QRNDFGAASA-N |
| XLogP | 4.69 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|