C24H27Cl2NO2 — CID 71655347
(4aS,5R,10bS)-5-cyclohexyl-9-(3,4-dichlorophenoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71655347) has the molecular formula C24H27Cl2NO2 and a molecular weight of 432.39 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-cyclohexyl-9-(3,4-dichlorophenoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-cyclohexyl-9-(3,4-dichlorophenoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71655347 |
| Molecular Formula | C24H27Cl2NO2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (4aS,5R,10bS)-5-cyclohexyl-9-(3,4-dichlorophenoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Clc1ccc(Oc2ccc3c(c2)[C@H]2OCCC[C@H]2[C@@H](C2CCCCC2)N3)cc1Cl |
| InChI | InChI=1S/C24H27Cl2NO2/c25-20-10-8-17(14-21(20)26)29-16-9-11-22-19(13-16)24-18(7-4-12-28-24)23(27-22)15-5-2-1-3-6-15/h8-11,13-15,18,23-24,27H,1-7,12H2/t18-,23+,24-/m0/s1 |
| InChIKey | RVVBFSLHYPTUOP-GLYQVZKVSA-N |
| XLogP | 7.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |