C24H28ClNO2 — CID 71655288
(4aS,5R,10bS)-9-(2-chlorophenoxy)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 71655288) has the molecular formula C24H28ClNO2 and a molecular weight of 397.95 g/mol. Its IUPAC name is (4aS,5R,10bS)-9-(2-chlorophenoxy)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-9-(2-chlorophenoxy)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 71655288 |
| Molecular Formula | C24H28ClNO2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (4aS,5R,10bS)-9-(2-chlorophenoxy)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Clc1ccccc1Oc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](C1CCCCC1)N2 |
| InChI | InChI=1S/C24H28ClNO2/c25-20-10-4-5-11-22(20)28-17-12-13-21-19(15-17)24-18(9-6-14-27-24)23(26-21)16-7-2-1-3-8-16/h4-5,10-13,15-16,18,23-24,26H,1-3,6-9,14H2/t18-,23+,24-/m0/s1 |
| InChIKey | WIUYYGQKVGTDQY-GLYQVZKVSA-N |
| XLogP | 6.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |