About prop-2-enehydrazide;hydrochloride
prop-2-enehydrazide;hydrochloride (PubChem CID 71656102) has the molecular formula C3H7ClN2O
and a molecular weight of 122.56 g/mol. Its IUPAC name is prop-2-enehydrazide;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enehydrazide;hydrochloride |
| PubChem CID | 71656102 |
| Molecular Formula | C3H7ClN2O |
| Molecular Weight | 122.56 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | prop-2-enehydrazide;hydrochloride |
| SMILES | C=CC(=O)NN.Cl |
| InChI | InChI=1S/C3H6N2O.ClH/c1-2-3(6)5-4;/h2H,1,4H2,(H,5,6);1H |
| InChIKey | RERYAUXONVNXSK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.56 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enehydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enehydrazide;hydrochloride?
The IUPAC name of prop-2-enehydrazide;hydrochloride (CID 71656102) is prop-2-enehydrazide;hydrochloride.
What is the SMILES notation for prop-2-enehydrazide;hydrochloride?
The canonical SMILES for prop-2-enehydrazide;hydrochloride is C=CC(=O)NN.Cl.
What is the InChIKey of prop-2-enehydrazide;hydrochloride?
The InChIKey is RERYAUXONVNXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O.ClH/c1-2-3(6)5-4;/h2H,1,4H2,(H,5,6);1H.
What are the key properties of prop-2-enehydrazide;hydrochloride?
prop-2-enehydrazide;hydrochloride has a molecular weight of 122.56 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enehydrazide;hydrochloride is sourced from PubChem (CID 71656102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).