C20H13F2NO4 — CID 71656325
N-[(3,4-difluorophenyl)methyl]-3-(7-methoxy-4-oxochromen-3-yl)prop-2-ynamide (PubChem CID 71656325) has the molecular formula C20H13F2NO4 and a molecular weight of 369.32 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-3-(7-methoxy-4-oxochromen-3-yl)prop-2-ynamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-3-(7-methoxy-4-oxochromen-3-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 71656325 |
| Molecular Formula | C20H13F2NO4 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-3-(7-methoxy-4-oxochromen-3-yl)prop-2-ynamide |
| SMILES | COc1ccc2c(=O)c(C#CC(=O)NCc3ccc(F)c(F)c3)coc2c1 |
| InChI | InChI=1S/C20H13F2NO4/c1-26-14-4-5-15-18(9-14)27-11-13(20(15)25)3-7-19(24)23-10-12-2-6-16(21)17(22)8-12/h2,4-6,8-9,11H,10H2,1H3,(H,23,24) |
| InChIKey | WLJVIEZZMMWMFT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|