C17H26O6 — CID 71661427
[(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(E)-2-methyl-3-oxobut-1-enyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate (PubChem CID 71661427) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(E)-2-methyl-3-oxobut-1-enyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate.
| Compound Name | [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(E)-2-methyl-3-oxobut-1-enyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 71661427 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(E)-2-methyl-3-oxobut-1-enyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate |
| SMILES | C=C(C)[C@@H](C[C@@H]1OC(C)(C)O[C@H]1/C=C(\C)C(C)=O)OC(=O)OC |
| InChI | InChI=1S/C17H26O6/c1-10(2)13(21-16(19)20-7)9-15-14(8-11(3)12(4)18)22-17(5,6)23-15/h8,13-15H,1,9H2,2-7H3/b11-8+/t13-,14+,15+/m1/s1 |
| InChIKey | GIHGALNSRSKCQT-KVJLEBMDSA-N |
| XLogP | 3.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|