C16H24O7 — CID 5363957
methyl (E)-4-(7-acetyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate (PubChem CID 5363957) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl (E)-4-(7-acetyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-(7-acetyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5363957 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl (E)-4-(7-acetyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate |
| SMILES | COC(=O)/C=C(\C)CC1OCC(OC(C)=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C16H24O7/c1-9(7-13(18)19-5)6-11-14-15(23-16(3,4)22-14)12(8-20-11)21-10(2)17/h7,11-12,14-15H,6,8H2,1-5H3/b9-7+ |
| InChIKey | SDJMKOBFAKZJIK-VQHVLOKHSA-N |
| XLogP | 1.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|