C15H24O6 — CID 5363359
methyl (E)-4-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate (PubChem CID 5363359) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is methyl (E)-4-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5363359 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | methyl (E)-4-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate |
| SMILES | COC(=O)/C=C(\C)CC1OCC(C)(O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C15H24O6/c1-9(7-11(16)18-5)6-10-12-13(15(4,17)8-19-10)21-14(2,3)20-12/h7,10,12-13,17H,6,8H2,1-5H3/b9-7+ |
| InChIKey | XHXMWGXTZXAJGC-VQHVLOKHSA-N |
| XLogP | 1.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|