C17H26O6 — CID 5362781
methyl (E)-4-(7-hydroxy-2,2-dimethyl-7-prop-2-enyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate (PubChem CID 5362781) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is methyl (E)-4-(7-hydroxy-2,2-dimethyl-7-prop-2-enyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-(7-hydroxy-2,2-dimethyl-7-prop-2-enyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5362781 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | methyl (E)-4-(7-hydroxy-2,2-dimethyl-7-prop-2-enyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)-3-methylbut-2-enoate |
| SMILES | C=CCC1(O)COC(C/C(C)=C/C(=O)OC)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C17H26O6/c1-6-7-17(19)10-21-12(8-11(2)9-13(18)20-5)14-15(17)23-16(3,4)22-14/h6,9,12,14-15,19H,1,7-8,10H2,2-5H3/b11-9+ |
| InChIKey | YXQBPNPNRQXFCY-PKNBQFBNSA-N |
| XLogP | 1.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|