C16H24O5 — CID 11243413
3-[(4S,5R)-4-ethyl-5-[(3R)-3-hydroxypent-1-en-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2H-furan-5-one (PubChem CID 11243413) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-[(4S,5R)-4-ethyl-5-[(3R)-3-hydroxypent-1-en-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2H-furan-5-one.
| Compound Name | 3-[(4S,5R)-4-ethyl-5-[(3R)-3-hydroxypent-1-en-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 11243413 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-[(4S,5R)-4-ethyl-5-[(3R)-3-hydroxypent-1-en-3-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2H-furan-5-one |
| SMILES | C=C[C@](O)(CC)[C@H]1OC(C)(C)O[C@@]1(CC)C1=CC(=O)OC1 |
| InChI | InChI=1S/C16H24O5/c1-6-15(18,7-2)13-16(8-3,21-14(4,5)20-13)11-9-12(17)19-10-11/h6,9,13,18H,1,7-8,10H2,2-5H3/t13-,15+,16+/m1/s1 |
| InChIKey | KDSBORTZJHODJS-KBMXLJTQSA-N |
| XLogP | 2.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|