C19H28O7 — CID 5363809
methyl (E)-4-(7-acetyloxy-2,2-dimethyl-3a-prop-2-enyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl)-3-methylbut-2-enoate (PubChem CID 5363809) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (E)-4-(7-acetyloxy-2,2-dimethyl-3a-prop-2-enyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl)-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-(7-acetyloxy-2,2-dimethyl-3a-prop-2-enyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl)-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5363809 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | methyl (E)-4-(7-acetyloxy-2,2-dimethyl-3a-prop-2-enyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl)-3-methylbut-2-enoate |
| SMILES | C=CCC12COC(C/C(C)=C/C(=O)OC)C(OC(C)=O)C1OC(C)(C)O2 |
| InChI | InChI=1S/C19H28O7/c1-7-8-19-11-23-14(9-12(2)10-15(21)22-6)16(24-13(3)20)17(19)25-18(4,5)26-19/h7,10,14,16-17H,1,8-9,11H2,2-6H3/b12-10+ |
| InChIKey | PRHPFBGNDHSKLM-ZRDIBKRKSA-N |
| XLogP | 2.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|