C17H28O4 — CID 71663610
(E)-6-[(2S,4S,6S)-4-hydroxy-3,3-dimethyl-6-(2-oxobutyl)oxan-2-yl]hex-4-en-3-one (PubChem CID 71663610) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (E)-6-[(2S,4S,6S)-4-hydroxy-3,3-dimethyl-6-(2-oxobutyl)oxan-2-yl]hex-4-en-3-one.
| Compound Name | (E)-6-[(2S,4S,6S)-4-hydroxy-3,3-dimethyl-6-(2-oxobutyl)oxan-2-yl]hex-4-en-3-one |
|---|---|
| PubChem CID | 71663610 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (E)-6-[(2S,4S,6S)-4-hydroxy-3,3-dimethyl-6-(2-oxobutyl)oxan-2-yl]hex-4-en-3-one |
| SMILES | CCC(=O)/C=C/C[C@@H]1O[C@H](CC(=O)CC)C[C@H](O)C1(C)C |
| InChI | InChI=1S/C17H28O4/c1-5-12(18)8-7-9-16-17(3,4)15(20)11-14(21-16)10-13(19)6-2/h7-8,14-16,20H,5-6,9-11H2,1-4H3/b8-7+/t14-,15+,16+/m1/s1 |
| InChIKey | OZCYTVLGPYYUQI-JRSRBHBDSA-N |
| XLogP | 2.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|