C16H17NO3 — CID 71663974
(3aS,7aR)-4,6,7a-trimethyl-3-phenyl-3a,4-dihydro-1,3-benzoxazole-2,5-dione (PubChem CID 71663974) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (3aS,7aR)-4,6,7a-trimethyl-3-phenyl-3a,4-dihydro-1,3-benzoxazole-2,5-dione.
| Compound Name | (3aS,7aR)-4,6,7a-trimethyl-3-phenyl-3a,4-dihydro-1,3-benzoxazole-2,5-dione |
|---|---|
| PubChem CID | 71663974 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3aS,7aR)-4,6,7a-trimethyl-3-phenyl-3a,4-dihydro-1,3-benzoxazole-2,5-dione |
| SMILES | CC1=C[C@@]2(C)OC(=O)N(c3ccccc3)[C@H]2C(C)C1=O |
| InChI | InChI=1S/C16H17NO3/c1-10-9-16(3)14(11(2)13(10)18)17(15(19)20-16)12-7-5-4-6-8-12/h4-9,11,14H,1-3H3/t11?,14-,16+/m0/s1 |
| InChIKey | CYIYSSXUCKUTLV-TWZNPMNKSA-N |
| XLogP | 2.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |