C20H25N3O3S2 — CID 71664313
2-[4-[(6-methoxy-2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]-1,2-thiazolidine (PubChem CID 71664313) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[4-[(6-methoxy-2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]-1,2-thiazolidine.
| Compound Name | 2-[4-[(6-methoxy-2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]-1,2-thiazolidine |
|---|---|
| PubChem CID | 71664313 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-[4-[(6-methoxy-2,4-dimethyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]-1,2-thiazolidine |
| SMILES | COc1ccc2c(c1)N(C)CC(C)N2S(=O)(=O)c1ccc(N2CCCS2)cc1 |
| InChI | InChI=1S/C20H25N3O3S2/c1-15-14-21(2)20-13-17(26-3)7-10-19(20)23(15)28(24,25)18-8-5-16(6-9-18)22-11-4-12-27-22/h5-10,13,15H,4,11-12,14H2,1-3H3 |
| InChIKey | YWQJHGUWLDIUJM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|