C13H13ClF4N4O — CID 71665287
2-chloro-5-fluoro-4-[3-(oxan-4-yl)-2-(trifluoromethyl)imidazol-4-yl]-1,4-dihydropyrimidine (PubChem CID 71665287) has the molecular formula C13H13ClF4N4O and a molecular weight of 352.72 g/mol. Its IUPAC name is 2-chloro-5-fluoro-4-[3-(oxan-4-yl)-2-(trifluoromethyl)imidazol-4-yl]-1,4-dihydropyrimidine.
| Compound Name | 2-chloro-5-fluoro-4-[3-(oxan-4-yl)-2-(trifluoromethyl)imidazol-4-yl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 71665287 |
| Molecular Formula | C13H13ClF4N4O |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-chloro-5-fluoro-4-[3-(oxan-4-yl)-2-(trifluoromethyl)imidazol-4-yl]-1,4-dihydropyrimidine |
| SMILES | FC1=CNC(Cl)=NC1c1cnc(C(F)(F)F)n1C1CCOCC1 |
| InChI | InChI=1S/C13H13ClF4N4O/c14-12-20-5-8(15)10(21-12)9-6-19-11(13(16,17)18)22(9)7-1-3-23-4-2-7/h5-7,10H,1-4H2,(H,20,21) |
| InChIKey | GIRCUAUVROFCLP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|