C18H26FN5O2 — CID 69042058
5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]-3-(oxan-4-yl)-4H-pyrimidin-2-amine (PubChem CID 69042058) has the molecular formula C18H26FN5O2 and a molecular weight of 363.44 g/mol. Its IUPAC name is 5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]-3-(oxan-4-yl)-4H-pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]-3-(oxan-4-yl)-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 69042058 |
| Molecular Formula | C18H26FN5O2 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]-3-(oxan-4-yl)-4H-pyrimidin-2-amine |
| SMILES | Cc1ncc(C2C(F)=CN=C(N)N2C2CCOCC2)n1C1CCOCC1 |
| InChI | InChI=1S/C18H26FN5O2/c1-12-21-11-16(23(12)13-2-6-25-7-3-13)17-15(19)10-22-18(20)24(17)14-4-8-26-9-5-14/h10-11,13-14,17H,2-9H2,1H3,(H2,20,22) |
| InChIKey | XUNMSMMIHUYOIW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |