About 2-pentylquinolizin-4-one
2-pentylquinolizin-4-one (PubChem CID 71665548) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-pentylquinolizin-4-one.
Molecular Properties
| Compound Name | 2-pentylquinolizin-4-one |
| PubChem CID | 71665548 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-pentylquinolizin-4-one |
| SMILES | CCCCCc1cc(=O)n2ccccc2c1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-4-7-12-10-13-8-5-6-9-15(13)14(16)11-12/h5-6,8-11H,2-4,7H2,1H3 |
| InChIKey | XIYUNUOALJKQFZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylquinolizin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylquinolizin-4-one?
The IUPAC name of 2-pentylquinolizin-4-one (CID 71665548) is 2-pentylquinolizin-4-one.
What is the SMILES notation for 2-pentylquinolizin-4-one?
The canonical SMILES for 2-pentylquinolizin-4-one is CCCCCc1cc(=O)n2ccccc2c1.
What is the InChIKey of 2-pentylquinolizin-4-one?
The InChIKey is XIYUNUOALJKQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-3-4-7-12-10-13-8-5-6-9-15(13)14(16)11-12/h5-6,8-11H,2-4,7H2,1H3.
What are the key properties of 2-pentylquinolizin-4-one?
2-pentylquinolizin-4-one has a molecular weight of 215.30 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylquinolizin-4-one is sourced from PubChem (CID 71665548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).