C15H20F3NO2 — CID 71668410
(NE)-N-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]hydroxylamine (PubChem CID 71668410) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is (NE)-N-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 71668410 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (NE)-N-[2,2,2-trifluoro-1-[4-methoxy-3,5-di(propan-2-yl)phenyl]ethylidene]hydroxylamine |
| SMILES | COc1c(C(C)C)cc(/C(=N\O)C(F)(F)F)cc1C(C)C |
| InChI | InChI=1S/C15H20F3NO2/c1-8(2)11-6-10(14(19-20)15(16,17)18)7-12(9(3)4)13(11)21-5/h6-9,20H,1-5H3/b19-14+ |
| InChIKey | KVUYFMNZLGEMCF-XMHGGMMESA-N |
| XLogP | 4.68 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|