C17H24F3NO2 — CID 71668420
(NE)-N-[1,1,1-trifluoro-4-[4-methoxy-3,5-di(propan-2-yl)phenyl]butan-2-ylidene]hydroxylamine (PubChem CID 71668420) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is (NE)-N-[1,1,1-trifluoro-4-[4-methoxy-3,5-di(propan-2-yl)phenyl]butan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1,1,1-trifluoro-4-[4-methoxy-3,5-di(propan-2-yl)phenyl]butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 71668420 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (NE)-N-[1,1,1-trifluoro-4-[4-methoxy-3,5-di(propan-2-yl)phenyl]butan-2-ylidene]hydroxylamine |
| SMILES | COc1c(C(C)C)cc(CC/C(=N\O)C(F)(F)F)cc1C(C)C |
| InChI | InChI=1S/C17H24F3NO2/c1-10(2)13-8-12(6-7-15(21-22)17(18,19)20)9-14(11(3)4)16(13)23-5/h8-11,22H,6-7H2,1-5H3/b21-15+ |
| InChIKey | MZTMDQAKGKJSSL-RCCKNPSSSA-N |
| XLogP | 5.27 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|