C16H12ClNO2S2 — CID 71668519
2-(4-methylphenyl)-5-phenyl-1,3-thiazole-4-sulfonyl chloride (PubChem CID 71668519) has the molecular formula C16H12ClNO2S2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-phenyl-1,3-thiazole-4-sulfonyl chloride.
| Compound Name | 2-(4-methylphenyl)-5-phenyl-1,3-thiazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 71668519 |
| Molecular Formula | C16H12ClNO2S2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-(4-methylphenyl)-5-phenyl-1,3-thiazole-4-sulfonyl chloride |
| SMILES | Cc1ccc(-c2nc(S(=O)(=O)Cl)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H12ClNO2S2/c1-11-7-9-13(10-8-11)15-18-16(22(17,19)20)14(21-15)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | OLQPNZULJFKHNQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |