C12H12N2O2S — CID 71670119
(E)-N-(5-acetyl-3-cyano-4-methylthiophen-2-yl)but-2-enamide (PubChem CID 71670119) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is (E)-N-(5-acetyl-3-cyano-4-methylthiophen-2-yl)but-2-enamide.
| Compound Name | (E)-N-(5-acetyl-3-cyano-4-methylthiophen-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 71670119 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (E)-N-(5-acetyl-3-cyano-4-methylthiophen-2-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1sc(C(C)=O)c(C)c1C#N |
| InChI | InChI=1S/C12H12N2O2S/c1-4-5-10(16)14-12-9(6-13)7(2)11(17-12)8(3)15/h4-5H,1-3H3,(H,14,16)/b5-4+ |
| InChIKey | BLLKRQSLPDAMEU-SNAWJCMRSA-N |
| XLogP | 2.65 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|